C21H27ClN4O2Si — CID 90398023
2-[[3-(6-chloropyrimidin-4-yl)-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 90398023) has the molecular formula C21H27ClN4O2Si and a molecular weight of 431.01 g/mol. Its IUPAC name is 2-[[3-(6-chloropyrimidin-4-yl)-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(6-chloropyrimidin-4-yl)-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 90398023 |
| Molecular Formula | C21H27ClN4O2Si |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[[3-(6-chloropyrimidin-4-yl)-5-(1-methylcyclopropyl)oxyindazol-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC1(Oc2ccc3nn(COCC[Si](C)(C)C)c(-c4cc(Cl)ncn4)c3c2)CC1 |
| InChI | InChI=1S/C21H27ClN4O2Si/c1-21(7-8-21)28-15-5-6-17-16(11-15)20(18-12-19(22)24-13-23-18)26(25-17)14-27-9-10-29(2,3)4/h5-6,11-13H,7-10,14H2,1-4H3 |
| InChIKey | HVSXNRSVCRWNSN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|