C30H32Cl2N8OSi — CID 159426350
3-(6-chloropyrimidin-4-yl)-5-methyl-1H-indazole;2-[[3-(6-chloropyrimidin-4-yl)-5-methylindazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 159426350) has the molecular formula C30H32Cl2N8OSi and a molecular weight of 619.63 g/mol. Its IUPAC name is 3-(6-chloropyrimidin-4-yl)-5-methyl-1H-indazole;2-[[3-(6-chloropyrimidin-4-yl)-5-methylindazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 3-(6-chloropyrimidin-4-yl)-5-methyl-1H-indazole;2-[[3-(6-chloropyrimidin-4-yl)-5-methylindazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 159426350 |
| Molecular Formula | C30H32Cl2N8OSi |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | 3-(6-chloropyrimidin-4-yl)-5-methyl-1H-indazole;2-[[3-(6-chloropyrimidin-4-yl)-5-methylindazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ccc2[nH]nc(-c3cc(Cl)ncn3)c2c1.Cc1ccc2c(c1)c(-c1cc(Cl)ncn1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C18H23ClN4OSi.C12H9ClN4/c1-13-5-6-16-14(9-13)18(15-10-17(19)21-11-20-15)22-23(16)12-24-7-8-25(2,3)4;1-7-2-3-9-8(4-7)12(17-16-9)10-5-11(13)15-6-14-10/h5-6,9-11H,7-8,12H2,1-4H3;2-6H,1H3,(H,16,17) |
| InChIKey | LQKDFCBUSHRFBU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|