C18H29N4O3Si+ — CID 153483574
4-[3-morpholin-4-yl-2-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazol-2-ium-5-yl]phenol (PubChem CID 153483574) has the molecular formula C18H29N4O3Si+ and a molecular weight of 377.54 g/mol. Its IUPAC name is 4-[3-morpholin-4-yl-2-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazol-2-ium-5-yl]phenol.
| Compound Name | 4-[3-morpholin-4-yl-2-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazol-2-ium-5-yl]phenol |
|---|---|
| PubChem CID | 153483574 |
| Molecular Formula | C18H29N4O3Si+ |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-[3-morpholin-4-yl-2-(2-trimethylsilylethoxymethyl)-1H-1,2,4-triazol-2-ium-5-yl]phenol |
| SMILES | C[Si](C)(C)CCOC[n+]1[nH]c(-c2ccc(O)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C18H28N4O3Si/c1-26(2,3)13-12-25-14-22-18(21-8-10-24-11-9-21)19-17(20-22)15-4-6-16(23)7-5-15/h4-7H,8-14H2,1-3H3,(H,20,23)/p+1 |
| InChIKey | QJXZFANVSNJTIO-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|