C18H13N5O2S — CID 15425581
2-[4-(4-hydroxyphenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 15425581) has the molecular formula C18H13N5O2S and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[4-(4-hydroxyphenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(4-hydroxyphenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 15425581 |
| Molecular Formula | C18H13N5O2S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-[4-(4-hydroxyphenyl)-2-morpholin-4-yl-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)c1sc(N2CCOCC2)nc1-c1ccc(O)cc1 |
| InChI | InChI=1S/C18H13N5O2S/c19-9-13(10-20)15(11-21)17-16(12-1-3-14(24)4-2-12)22-18(26-17)23-5-7-25-8-6-23/h1-4,24H,5-8H2 |
| InChIKey | OVWNZXUFVPJIJW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|