C23H33N5O4SSi — CID 58137160
trimethyl-[2-[[5-[4-(methylsulfonylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]benzimidazol-1-yl]methoxy]ethyl]silane (PubChem CID 58137160) has the molecular formula C23H33N5O4SSi and a molecular weight of 503.70 g/mol. Its IUPAC name is trimethyl-[2-[[5-[4-(methylsulfonylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]benzimidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-[4-(methylsulfonylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]benzimidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 58137160 |
| Molecular Formula | C23H33N5O4SSi |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | trimethyl-[2-[[5-[4-(methylsulfonylmethyl)-6-morpholin-4-ylpyrimidin-2-yl]benzimidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cnc2cc(-c3nc(CS(C)(=O)=O)cc(N4CCOCC4)n3)ccc21 |
| InChI | InChI=1S/C23H33N5O4SSi/c1-33(29,30)15-19-14-22(27-7-9-31-10-8-27)26-23(25-19)18-5-6-21-20(13-18)24-16-28(21)17-32-11-12-34(2,3)4/h5-6,13-14,16H,7-12,15,17H2,1-4H3 |
| InChIKey | FHINJXDGRBRLDQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|