C24H24N4O3S — CID 58137164
4-[6-(benzenesulfonylmethyl)-2-(1-methylindol-5-yl)pyrimidin-4-yl]morpholine (PubChem CID 58137164) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-[6-(benzenesulfonylmethyl)-2-(1-methylindol-5-yl)pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-(benzenesulfonylmethyl)-2-(1-methylindol-5-yl)pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 58137164 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[6-(benzenesulfonylmethyl)-2-(1-methylindol-5-yl)pyrimidin-4-yl]morpholine |
| SMILES | Cn1ccc2cc(-c3nc(CS(=O)(=O)c4ccccc4)cc(N4CCOCC4)n3)ccc21 |
| InChI | InChI=1S/C24H24N4O3S/c1-27-10-9-18-15-19(7-8-22(18)27)24-25-20(16-23(26-24)28-11-13-31-14-12-28)17-32(29,30)21-5-3-2-4-6-21/h2-10,15-16H,11-14,17H2,1H3 |
| InChIKey | BXDVOFVXNUQQTK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |