C24H24N4O3S — CID 70843177
(3S)-4-[6-(benzenesulfonylmethyl)-2-(3H-indol-6-yl)pyrimidin-4-yl]-3-methylmorpholine (PubChem CID 70843177) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is (3S)-4-[6-(benzenesulfonylmethyl)-2-(3H-indol-6-yl)pyrimidin-4-yl]-3-methylmorpholine.
| Compound Name | (3S)-4-[6-(benzenesulfonylmethyl)-2-(3H-indol-6-yl)pyrimidin-4-yl]-3-methylmorpholine |
|---|---|
| PubChem CID | 70843177 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (3S)-4-[6-(benzenesulfonylmethyl)-2-(3H-indol-6-yl)pyrimidin-4-yl]-3-methylmorpholine |
| SMILES | C[C@H]1COCCN1c1cc(CS(=O)(=O)c2ccccc2)nc(-c2ccc3c(c2)N=CC3)n1 |
| InChI | InChI=1S/C24H24N4O3S/c1-17-15-31-12-11-28(17)23-14-20(16-32(29,30)21-5-3-2-4-6-21)26-24(27-23)19-8-7-18-9-10-25-22(18)13-19/h2-8,10,13-14,17H,9,11-12,15-16H2,1H3/t17-/m0/s1 |
| InChIKey | OANJYJDSEFGIPD-KRWDZBQOSA-N |
| XLogP | 3.60 |
| TPSA | 84.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |