About 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine
1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine (PubChem CID 168814989) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine.
Molecular Properties
| Compound Name | 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine |
| PubChem CID | 168814989 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine |
| SMILES | COc1cc2c(cnn2C(C)(C)C)nc1-c1cccc(C)c1C |
| InChI | InChI=1S/C19H23N3O/c1-12-8-7-9-14(13(12)2)18-17(23-6)10-16-15(21-18)11-20-22(16)19(3,4)5/h7-11H,1-6H3 |
| InChIKey | XAUOQWCMFMDWMP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine?
The IUPAC name of 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine (CID 168814989) is 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine.
What is the SMILES notation for 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine?
The canonical SMILES for 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine is COc1cc2c(cnn2C(C)(C)C)nc1-c1cccc(C)c1C.
What is the InChIKey of 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine?
The InChIKey is XAUOQWCMFMDWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O/c1-12-8-7-9-14(13(12)2)18-17(23-6)10-16-15(21-18)11-20-22(16)19(3,4)5/h7-11H,1-6H3.
What are the key properties of 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine?
1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine has a molecular weight of 309.41 g/mol, XLogP of 4.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5-(2,3-dimethylphenyl)-6-methoxypyrazolo[4,3-b]pyridine is sourced from PubChem (CID 168814989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).