C31H41N5O2Si — CID 156674722
2-[[5-(2,3-dimethylphenyl)-6-methoxy-3-(6-piperidin-4-yl-3-pyridinyl)pyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 156674722) has the molecular formula C31H41N5O2Si and a molecular weight of 543.79 g/mol. Its IUPAC name is 2-[[5-(2,3-dimethylphenyl)-6-methoxy-3-(6-piperidin-4-yl-3-pyridinyl)pyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(2,3-dimethylphenyl)-6-methoxy-3-(6-piperidin-4-yl-3-pyridinyl)pyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 156674722 |
| Molecular Formula | C31H41N5O2Si |
| Molecular Weight | 543.79 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 2-[[5-(2,3-dimethylphenyl)-6-methoxy-3-(6-piperidin-4-yl-3-pyridinyl)pyrazolo[4,3-b]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1cc2c(nc1-c1cccc(C)c1C)c(-c1ccc(C3CCNCC3)nc1)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C31H41N5O2Si/c1-21-8-7-9-25(22(21)2)30-28(37-3)18-27-31(34-30)29(35-36(27)20-38-16-17-39(4,5)6)24-10-11-26(33-19-24)23-12-14-32-15-13-23/h7-11,18-19,23,32H,12-17,20H2,1-6H3 |
| InChIKey | ZGQMEGJEXKXFTL-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.79 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|