C22H23BrF3N3OSi — CID 123493003
2-[[3-bromo-5-(2,6-difluorophenyl)-7-fluoro-4,5-dihydropyrazolo[4,3-c]isoquinolin-2-yl]methoxy]ethyl-trimethylsilane (PubChem CID 123493003) has the molecular formula C22H23BrF3N3OSi and a molecular weight of 510.43 g/mol. Its IUPAC name is 2-[[3-bromo-5-(2,6-difluorophenyl)-7-fluoro-4,5-dihydropyrazolo[4,3-c]isoquinolin-2-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-5-(2,6-difluorophenyl)-7-fluoro-4,5-dihydropyrazolo[4,3-c]isoquinolin-2-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 123493003 |
| Molecular Formula | C22H23BrF3N3OSi |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | 2-[[3-bromo-5-(2,6-difluorophenyl)-7-fluoro-4,5-dihydropyrazolo[4,3-c]isoquinolin-2-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc2c(c1Br)NC(c1c(F)cccc1F)c1cc(F)ccc1-2 |
| InChI | InChI=1S/C22H23BrF3N3OSi/c1-31(2,3)10-9-30-12-29-22(23)21-20(28-29)14-8-7-13(24)11-15(14)19(27-21)18-16(25)5-4-6-17(18)26/h4-8,11,19,27H,9-10,12H2,1-3H3 |
| InChIKey | UENKTMQXUJMCKP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|