C25H32F2N4O3Si — CID 151106349
ethyl 3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 151106349) has the molecular formula C25H32F2N4O3Si and a molecular weight of 502.64 g/mol. Its IUPAC name is ethyl 3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | ethyl 3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 151106349 |
| Molecular Formula | C25H32F2N4O3Si |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | ethyl 3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)c(N1CCC[C@@H]1c1cc(F)ccc1F)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H32F2N4O3Si/c1-5-34-25(32)17-13-20-23(28-15-17)31(16-33-11-12-35(2,3)4)29-24(20)30-10-6-7-22(30)19-14-18(26)8-9-21(19)27/h8-9,13-15,22H,5-7,10-12,16H2,1-4H3/t22-/m1/s1 |
| InChIKey | MPEMHHUNORFVDZ-JOCHJYFZSA-N |
| XLogP | 5.54 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|