C20H20F2N4O3 — CID 165017268
1-[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1H-pyrazolo[5,4-b]pyridin-5-yl]-2-(2-hydroxyethoxy)ethanone (PubChem CID 165017268) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is 1-[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1H-pyrazolo[5,4-b]pyridin-5-yl]-2-(2-hydroxyethoxy)ethanone.
| Compound Name | 1-[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1H-pyrazolo[5,4-b]pyridin-5-yl]-2-(2-hydroxyethoxy)ethanone |
|---|---|
| PubChem CID | 165017268 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-1H-pyrazolo[5,4-b]pyridin-5-yl]-2-(2-hydroxyethoxy)ethanone |
| SMILES | O=C(COCCO)c1cnc2[nH]nc(N3CCC[C@@H]3c3cc(F)ccc3F)c2c1 |
| InChI | InChI=1S/C20H20F2N4O3/c21-13-3-4-16(22)14(9-13)17-2-1-5-26(17)20-15-8-12(10-23-19(15)24-25-20)18(28)11-29-7-6-27/h3-4,8-10,17,27H,1-2,5-7,11H2,(H,23,24,25)/t17-/m1/s1 |
| InChIKey | PDYBZAMMMSNQSC-QGZVFWFLSA-N |
| XLogP | 2.77 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|