C19H26F2N4O3Si — CID 175018323
2-[[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-5-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 175018323) has the molecular formula C19H26F2N4O3Si and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-5-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-5-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175018323 |
| Molecular Formula | C19H26F2N4O3Si |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[[3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-5-nitropyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(N2CCC[C@@H]2c2cc(F)ccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26F2N4O3Si/c1-29(2,3)10-9-28-13-24-19(25(26)27)12-18(22-24)23-8-4-5-17(23)15-11-14(20)6-7-16(15)21/h6-7,11-12,17H,4-5,8-10,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | CGGJSKVTSAUQDS-QGZVFWFLSA-N |
| XLogP | 4.72 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|