C24H20F5N5O3 — CID 156771241
1-[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 156771241) has the molecular formula C24H20F5N5O3 and a molecular weight of 521.45 g/mol. Its IUPAC name is 1-[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 156771241 |
| Molecular Formula | C24H20F5N5O3 |
| Molecular Weight | 521.45 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-[6-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)Nc1nc(N2CCC[C@@H]2c2cc(F)ccc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20F5N5O3/c25-16-7-8-18(26)17(12-16)19-2-1-11-33(19)21-10-9-20(34(36)37)22(31-21)32-23(35)30-13-14-3-5-15(6-4-14)24(27,28)29/h3-10,12,19H,1-2,11,13H2,(H2,30,31,32,35)/t19-/m1/s1 |
| InChIKey | QOFVUQBGMKLFLM-LJQANCHMSA-N |
| XLogP | 5.95 |
| TPSA | 100.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|