C22H25F2N5O4 — CID 175134138
1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 175134138) has the molecular formula C22H25F2N5O4 and a molecular weight of 461.47 g/mol. Its IUPAC name is 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 175134138 |
| Molecular Formula | C22H25F2N5O4 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 1-[6-[2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | O=C(Nc1nc(N2CCCC2c2cc(F)ccc2F)ccc1[N+](=O)[O-])NC1CCC(O)CC1 |
| InChI | InChI=1S/C22H25F2N5O4/c23-13-3-8-17(24)16(12-13)18-2-1-11-28(18)20-10-9-19(29(32)33)21(26-20)27-22(31)25-14-4-6-15(30)7-5-14/h3,8-10,12,14-15,18,30H,1-2,4-7,11H2,(H2,25,26,27,31) |
| InChIKey | WONXGTSJSOQSEX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 120.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|