C27H30FN5O5 — CID 175143096
1-[6-[[(1R)-1-(5-fluoro-2-phenylmethoxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea (PubChem CID 175143096) has the molecular formula C27H30FN5O5 and a molecular weight of 523.57 g/mol. Its IUPAC name is 1-[6-[[(1R)-1-(5-fluoro-2-phenylmethoxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea.
| Compound Name | 1-[6-[[(1R)-1-(5-fluoro-2-phenylmethoxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea |
|---|---|
| PubChem CID | 175143096 |
| Molecular Formula | C27H30FN5O5 |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 1-[6-[[(1R)-1-(5-fluoro-2-phenylmethoxyphenyl)ethyl]amino]-3-nitro-2-pyridinyl]-3-(4-hydroxycyclohexyl)urea |
| SMILES | C[C@@H](Nc1ccc([N+](=O)[O-])c(NC(=O)NC2CCC(O)CC2)n1)c1cc(F)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H30FN5O5/c1-17(22-15-19(28)7-13-24(22)38-16-18-5-3-2-4-6-18)29-25-14-12-23(33(36)37)26(31-25)32-27(35)30-20-8-10-21(34)11-9-20/h2-7,12-15,17,20-21,34H,8-11,16H2,1H3,(H3,29,30,31,32,35)/t17-,20?,21?/m1/s1 |
| InChIKey | LNEFPUWCQQONEB-MDMXATFFSA-N |
| XLogP | 5.31 |
| TPSA | 138.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|