C20H24FN3O4 — CID 133454308
1-[4-fluoro-2-[1-(3-methoxy-4-nitroanilino)ethyl]phenyl]piperidin-4-ol (PubChem CID 133454308) has the molecular formula C20H24FN3O4 and a molecular weight of 389.43 g/mol. Its IUPAC name is 1-[4-fluoro-2-[1-(3-methoxy-4-nitroanilino)ethyl]phenyl]piperidin-4-ol.
| Compound Name | 1-[4-fluoro-2-[1-(3-methoxy-4-nitroanilino)ethyl]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 133454308 |
| Molecular Formula | C20H24FN3O4 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-[4-fluoro-2-[1-(3-methoxy-4-nitroanilino)ethyl]phenyl]piperidin-4-ol |
| SMILES | COc1cc(NC(C)c2cc(F)ccc2N2CCC(O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H24FN3O4/c1-13(22-15-4-6-19(24(26)27)20(12-15)28-2)17-11-14(21)3-5-18(17)23-9-7-16(25)8-10-23/h3-6,11-13,16,22,25H,7-10H2,1-2H3 |
| InChIKey | KAVRJGKDYWCXNE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|