C15H19FN2O4 — CID 119034038
2-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethylamino]-2-oxoacetic acid (PubChem CID 119034038) has the molecular formula C15H19FN2O4 and a molecular weight of 310.33 g/mol. Its IUPAC name is 2-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethylamino]-2-oxoacetic acid.
| Compound Name | 2-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 119034038 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethylamino]-2-oxoacetic acid |
| SMILES | CC(NC(=O)C(=O)O)c1cc(F)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C15H19FN2O4/c1-9(17-14(20)15(21)22)12-8-10(16)2-3-13(12)18-6-4-11(19)5-7-18/h2-3,8-9,11,19H,4-7H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | LWXMWGMOHWJNDF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|