C16H24FN3O2 — CID 95760153
1-ethyl-3-[(1R)-1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]urea (PubChem CID 95760153) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-ethyl-3-[(1R)-1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]urea.
| Compound Name | 1-ethyl-3-[(1R)-1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 95760153 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 1-ethyl-3-[(1R)-1-[5-fluoro-2-(4-hydroxypiperidin-1-yl)phenyl]ethyl]urea |
| SMILES | CCNC(=O)N[C@H](C)c1cc(F)ccc1N1CCC(O)CC1 |
| InChI | InChI=1S/C16H24FN3O2/c1-3-18-16(22)19-11(2)14-10-12(17)4-5-15(14)20-8-6-13(21)7-9-20/h4-5,10-11,13,21H,3,6-9H2,1-2H3,(H2,18,19,22)/t11-/m1/s1 |
| InChIKey | XYLHDWVBQFEQGS-LLVKDONJSA-N |
| XLogP | 2.17 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |