C20H23ClFN3O3 — CID 133454276
1-[2-[1-(2-chloro-5-methyl-4-nitroanilino)ethyl]-4-fluorophenyl]piperidin-4-ol (PubChem CID 133454276) has the molecular formula C20H23ClFN3O3 and a molecular weight of 407.87 g/mol. Its IUPAC name is 1-[2-[1-(2-chloro-5-methyl-4-nitroanilino)ethyl]-4-fluorophenyl]piperidin-4-ol.
| Compound Name | 1-[2-[1-(2-chloro-5-methyl-4-nitroanilino)ethyl]-4-fluorophenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 133454276 |
| Molecular Formula | C20H23ClFN3O3 |
| Molecular Weight | 407.87 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 1-[2-[1-(2-chloro-5-methyl-4-nitroanilino)ethyl]-4-fluorophenyl]piperidin-4-ol |
| SMILES | Cc1cc(NC(C)c2cc(F)ccc2N2CCC(O)CC2)c(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H23ClFN3O3/c1-12-9-18(17(21)11-20(12)25(27)28)23-13(2)16-10-14(22)3-4-19(16)24-7-5-15(26)6-8-24/h3-4,9-11,13,15,23,26H,5-8H2,1-2H3 |
| InChIKey | LZHVUCOIABIXGL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|