C17H17F2N3O3 — CID 133320558
1-(2,4-difluorophenyl)-N-(3-methoxy-4-nitrophenyl)pyrrolidin-3-amine (PubChem CID 133320558) has the molecular formula C17H17F2N3O3 and a molecular weight of 349.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-(3-methoxy-4-nitrophenyl)pyrrolidin-3-amine.
| Compound Name | 1-(2,4-difluorophenyl)-N-(3-methoxy-4-nitrophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 133320558 |
| Molecular Formula | C17H17F2N3O3 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-(3-methoxy-4-nitrophenyl)pyrrolidin-3-amine |
| SMILES | COc1cc(NC2CCN(c3ccc(F)cc3F)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17F2N3O3/c1-25-17-9-12(3-5-16(17)22(23)24)20-13-6-7-21(10-13)15-4-2-11(18)8-14(15)19/h2-5,8-9,13,20H,6-7,10H2,1H3 |
| InChIKey | YVRVNPBEKNUUCV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|