C14H13F2N3O2 — CID 174941019
2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-nitro-1H-pyrrole (PubChem CID 174941019) has the molecular formula C14H13F2N3O2 and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-nitro-1H-pyrrole.
| Compound Name | 2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-nitro-1H-pyrrole |
|---|---|
| PubChem CID | 174941019 |
| Molecular Formula | C14H13F2N3O2 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-4-nitro-1H-pyrrole |
| SMILES | O=[N+]([O-])c1c[nH]c(N2CCC[C@@H]2c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C14H13F2N3O2/c15-9-3-4-12(16)11(6-9)13-2-1-5-18(13)14-7-10(8-17-14)19(20)21/h3-4,6-8,13,17H,1-2,5H2/t13-/m1/s1 |
| InChIKey | NSOQDCIYEHCPHT-CYBMUJFWSA-N |
| XLogP | 3.54 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|