C13H15F2NO — CID 176681918
2-(2,5-difluorophenyl)azepane-1-carbaldehyde (PubChem CID 176681918) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)azepane-1-carbaldehyde.
| Compound Name | 2-(2,5-difluorophenyl)azepane-1-carbaldehyde |
|---|---|
| PubChem CID | 176681918 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)azepane-1-carbaldehyde |
| SMILES | O=CN1CCCCCC1c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2NO/c14-10-5-6-12(15)11(8-10)13-4-2-1-3-7-16(13)9-17/h5-6,8-9,13H,1-4,7H2 |
| InChIKey | HTGMCHYXDGMTQE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|