C10H11F2N — CID 68991011
2-(2,5-difluorophenyl)-1-methylazetidine (PubChem CID 68991011) has the molecular formula C10H11F2N and a molecular weight of 183.20 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-methylazetidine.
| Compound Name | 2-(2,5-difluorophenyl)-1-methylazetidine |
|---|---|
| PubChem CID | 68991011 |
| Molecular Formula | C10H11F2N |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-methylazetidine |
| SMILES | CN1CCC1c1cc(F)ccc1F |
| InChI | InChI=1S/C10H11F2N/c1-13-5-4-10(13)8-6-7(11)2-3-9(8)12/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | HAKYFPQAQGPXCW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |