C14H19F2NO — CID 158694292
(3R,5R)-1-tert-butyl-5-(2,5-difluorophenyl)pyrrolidin-3-ol (PubChem CID 158694292) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is (3R,5R)-1-tert-butyl-5-(2,5-difluorophenyl)pyrrolidin-3-ol.
| Compound Name | (3R,5R)-1-tert-butyl-5-(2,5-difluorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 158694292 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (3R,5R)-1-tert-butyl-5-(2,5-difluorophenyl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)N1C[C@H](O)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2NO/c1-14(2,3)17-8-10(18)7-13(17)11-6-9(15)4-5-12(11)16/h4-6,10,13,18H,7-8H2,1-3H3/t10-,13-/m1/s1 |
| InChIKey | IGSXACBCFUZWQA-ZWNOBZJWSA-N |
| XLogP | 2.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |