C15H13F2N5O — CID 129381401
(3S,5S)-5-(2,5-difluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol (PubChem CID 129381401) has the molecular formula C15H13F2N5O and a molecular weight of 317.30 g/mol. Its IUPAC name is (3S,5S)-5-(2,5-difluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol.
| Compound Name | (3S,5S)-5-(2,5-difluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129381401 |
| Molecular Formula | C15H13F2N5O |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (3S,5S)-5-(2,5-difluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol |
| SMILES | O[C@H]1C[C@@H](c2cc(F)ccc2F)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C15H13F2N5O/c16-8-1-2-11(17)10(3-8)12-4-9(23)5-22(12)15-13-14(19-6-18-13)20-7-21-15/h1-3,6-7,9,12,23H,4-5H2,(H,18,19,20,21)/t9-,12-/m0/s1 |
| InChIKey | CIMPIVDZVZQREU-CABZTGNLSA-N |
| XLogP | 1.94 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |