C16H14F3N5O — CID 129381170
(3S,5R)-1-(7H-purin-6-yl)-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol (PubChem CID 129381170) has the molecular formula C16H14F3N5O and a molecular weight of 349.32 g/mol. Its IUPAC name is (3S,5R)-1-(7H-purin-6-yl)-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol.
| Compound Name | (3S,5R)-1-(7H-purin-6-yl)-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129381170 |
| Molecular Formula | C16H14F3N5O |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | (3S,5R)-1-(7H-purin-6-yl)-5-[3-(trifluoromethyl)phenyl]pyrrolidin-3-ol |
| SMILES | O[C@H]1C[C@H](c2cccc(C(F)(F)F)c2)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C16H14F3N5O/c17-16(18,19)10-3-1-2-9(4-10)12-5-11(25)6-24(12)15-13-14(21-7-20-13)22-8-23-15/h1-4,7-8,11-12,25H,5-6H2,(H,20,21,22,23)/t11-,12+/m0/s1 |
| InChIKey | KAGNRYHIMIDAEX-NWDGAFQWSA-N |
| XLogP | 2.68 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |