C15H14FN5O — CID 129447470
(3R,5R)-5-(3-fluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol (PubChem CID 129447470) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is (3R,5R)-5-(3-fluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol.
| Compound Name | (3R,5R)-5-(3-fluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129447470 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3R,5R)-5-(3-fluorophenyl)-1-(7H-purin-6-yl)pyrrolidin-3-ol |
| SMILES | O[C@@H]1C[C@H](c2cccc(F)c2)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C15H14FN5O/c16-10-3-1-2-9(4-10)12-5-11(22)6-21(12)15-13-14(18-7-17-13)19-8-20-15/h1-4,7-8,11-12,22H,5-6H2,(H,17,18,19,20)/t11-,12-/m1/s1 |
| InChIKey | OCXWWBUQRLJLBA-VXGBXAGGSA-N |
| XLogP | 1.80 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |