C17H15FN2O — CID 129349528
4-[(2R,4S)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]benzonitrile (PubChem CID 129349528) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-[(2R,4S)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(2R,4S)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 129349528 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 4-[(2R,4S)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@@H](O)C[C@@H]2c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C17H15FN2O/c18-14-3-1-2-13(8-14)17-9-16(21)11-20(17)15-6-4-12(10-19)5-7-15/h1-8,16-17,21H,9,11H2/t16-,17+/m0/s1 |
| InChIKey | UCHYLBUDLFHIND-DLBZAZTESA-N |
| XLogP | 3.01 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |