C15H14ClFN2O — CID 129480765
(3S,5R)-1-(5-chloro-2-pyridinyl)-5-(3-fluorophenyl)pyrrolidin-3-ol (PubChem CID 129480765) has the molecular formula C15H14ClFN2O and a molecular weight of 292.74 g/mol. Its IUPAC name is (3S,5R)-1-(5-chloro-2-pyridinyl)-5-(3-fluorophenyl)pyrrolidin-3-ol.
| Compound Name | (3S,5R)-1-(5-chloro-2-pyridinyl)-5-(3-fluorophenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 129480765 |
| Molecular Formula | C15H14ClFN2O |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (3S,5R)-1-(5-chloro-2-pyridinyl)-5-(3-fluorophenyl)pyrrolidin-3-ol |
| SMILES | O[C@H]1C[C@H](c2cccc(F)c2)N(c2ccc(Cl)cn2)C1 |
| InChI | InChI=1S/C15H14ClFN2O/c16-11-4-5-15(18-8-11)19-9-13(20)7-14(19)10-2-1-3-12(17)6-10/h1-6,8,13-14,20H,7,9H2/t13-,14+/m0/s1 |
| InChIKey | ZHXJPCROLMWQSU-UONOGXRCSA-N |
| XLogP | 3.19 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |