C18H18F3NO2 — CID 71844705
5-(2,5-difluorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-ol (PubChem CID 71844705) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-ol.
| Compound Name | 5-(2,5-difluorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 71844705 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-(2,5-difluorophenyl)-1-[2-(4-fluorophenoxy)ethyl]pyrrolidin-3-ol |
| SMILES | OC1CC(c2cc(F)ccc2F)N(CCOc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C18H18F3NO2/c19-12-1-4-15(5-2-12)24-8-7-22-11-14(23)10-18(22)16-9-13(20)3-6-17(16)21/h1-6,9,14,18,23H,7-8,10-11H2 |
| InChIKey | QBMQHHIZLRYNER-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |