C16H22F2N2O3 — CID 129380429
2-[(2R,4S)-2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-N-(2-ethoxyethyl)acetamide (PubChem CID 129380429) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-[(2R,4S)-2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-N-(2-ethoxyethyl)acetamide.
| Compound Name | 2-[(2R,4S)-2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-N-(2-ethoxyethyl)acetamide |
|---|---|
| PubChem CID | 129380429 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 2-[(2R,4S)-2-(2,5-difluorophenyl)-4-hydroxypyrrolidin-1-yl]-N-(2-ethoxyethyl)acetamide |
| SMILES | CCOCCNC(=O)CN1C[C@@H](O)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C16H22F2N2O3/c1-2-23-6-5-19-16(22)10-20-9-12(21)8-15(20)13-7-11(17)3-4-14(13)18/h3-4,7,12,15,21H,2,5-6,8-10H2,1H3,(H,19,22)/t12-,15+/m0/s1 |
| InChIKey | TWAUASTZILAKHW-SWLSCSKDSA-N |
| XLogP | 1.23 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|