C12H16F2N2 — CID 129068214
5-(2,5-difluorophenyl)-N,1-dimethylpyrrolidin-3-amine (PubChem CID 129068214) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N,1-dimethylpyrrolidin-3-amine.
| Compound Name | 5-(2,5-difluorophenyl)-N,1-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 129068214 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N,1-dimethylpyrrolidin-3-amine |
| SMILES | CNC1CC(c2cc(F)ccc2F)N(C)C1 |
| InChI | InChI=1S/C12H16F2N2/c1-15-9-6-12(16(2)7-9)10-5-8(13)3-4-11(10)14/h3-5,9,12,15H,6-7H2,1-2H3 |
| InChIKey | JFBRCXIYIDFCKA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |