C19H18ClN5O3 — CID 162527354
5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(2-methoxyethyl)-1H-pyrazolo[3,4-c]pyridine-3-carboxamide (PubChem CID 162527354) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(2-methoxyethyl)-1H-pyrazolo[3,4-c]pyridine-3-carboxamide.
| Compound Name | 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(2-methoxyethyl)-1H-pyrazolo[3,4-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 162527354 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 5-[3-chloro-5-(prop-2-enoylamino)phenyl]-N-(2-methoxyethyl)-1H-pyrazolo[3,4-c]pyridine-3-carboxamide |
| SMILES | C=CC(=O)Nc1cc(Cl)cc(-c2cc3c(C(=O)NCCOC)n[nH]c3cn2)c1 |
| InChI | InChI=1S/C19H18ClN5O3/c1-3-17(26)23-13-7-11(6-12(20)8-13)15-9-14-16(10-22-15)24-25-18(14)19(27)21-4-5-28-2/h3,6-10H,1,4-5H2,2H3,(H,21,27)(H,23,26)(H,24,25) |
| InChIKey | WLDUTBOEOLDBQT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|