C17H16ClN3O — CID 162526973
N-[3-(4-amino-3-ethanimidoylphenyl)-5-chlorophenyl]prop-2-enamide (PubChem CID 162526973) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is N-[3-(4-amino-3-ethanimidoylphenyl)-5-chlorophenyl]prop-2-enamide.
| Compound Name | N-[3-(4-amino-3-ethanimidoylphenyl)-5-chlorophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 162526973 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-[3-(4-amino-3-ethanimidoylphenyl)-5-chlorophenyl]prop-2-enamide |
| SMILES | [H]/N=C(\C)c1cc(-c2cc(Cl)cc(NC(=O)C=C)c2)ccc1N |
| InChI | InChI=1S/C17H16ClN3O/c1-3-17(22)21-14-7-12(6-13(18)9-14)11-4-5-16(20)15(8-11)10(2)19/h3-9,19H,1,20H2,2H3,(H,21,22)/b19-10+ |
| InChIKey | OZYBYAHPQOAEIS-VXLYETTFSA-N |
| XLogP | 4.10 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|