C28H38F3N5O4Si — CID 177368453
2-amino-3,3-dicyclopropyl-N-[(3S)-3-methyl-2-oxo-3-[(4S)-2-oxo-4-(trifluoromethyl)imidazolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indol-6-yl]prop-2-enamide (PubChem CID 177368453) has the molecular formula C28H38F3N5O4Si and a molecular weight of 593.72 g/mol. Its IUPAC name is 2-amino-3,3-dicyclopropyl-N-[(3S)-3-methyl-2-oxo-3-[(4S)-2-oxo-4-(trifluoromethyl)imidazolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indol-6-yl]prop-2-enamide.
| Compound Name | 2-amino-3,3-dicyclopropyl-N-[(3S)-3-methyl-2-oxo-3-[(4S)-2-oxo-4-(trifluoromethyl)imidazolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 177368453 |
| Molecular Formula | C28H38F3N5O4Si |
| Molecular Weight | 593.72 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | 2-amino-3,3-dicyclopropyl-N-[(3S)-3-methyl-2-oxo-3-[(4S)-2-oxo-4-(trifluoromethyl)imidazolidin-1-yl]-1-(2-trimethylsilylethoxymethyl)indol-6-yl]prop-2-enamide |
| SMILES | C[C@@]1(N2C[C@@H](C(F)(F)F)NC2=O)C(=O)N(COCC[Si](C)(C)C)c2cc(NC(=O)C(N)=C(C3CC3)C3CC3)ccc21 |
| InChI | InChI=1S/C28H38F3N5O4Si/c1-27(36-14-21(28(29,30)31)34-26(36)39)19-10-9-18(33-24(37)23(32)22(16-5-6-16)17-7-8-17)13-20(19)35(25(27)38)15-40-11-12-41(2,3)4/h9-10,13,16-17,21H,5-8,11-12,14-15,32H2,1-4H3,(H,33,37)(H,34,39)/t21-,27-/m0/s1 |
| InChIKey | YHILXRNAWJGDQU-IDISGSTGSA-N |
| XLogP | 4.49 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.72 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|