C22H24FN3O3 — CID 73426356
N-[1-(3-cyclopropyloxypropyl)-3,3-dimethyl-2-oxoindol-6-yl]-3-fluoropyridine-4-carboxamide (PubChem CID 73426356) has the molecular formula C22H24FN3O3 and a molecular weight of 397.45 g/mol. Its IUPAC name is N-[1-(3-cyclopropyloxypropyl)-3,3-dimethyl-2-oxoindol-6-yl]-3-fluoropyridine-4-carboxamide.
| Compound Name | N-[1-(3-cyclopropyloxypropyl)-3,3-dimethyl-2-oxoindol-6-yl]-3-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 73426356 |
| Molecular Formula | C22H24FN3O3 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[1-(3-cyclopropyloxypropyl)-3,3-dimethyl-2-oxoindol-6-yl]-3-fluoropyridine-4-carboxamide |
| SMILES | CC1(C)C(=O)N(CCCOC2CC2)c2cc(NC(=O)c3ccncc3F)ccc21 |
| InChI | InChI=1S/C22H24FN3O3/c1-22(2)17-7-4-14(25-20(27)16-8-9-24-13-18(16)23)12-19(17)26(21(22)28)10-3-11-29-15-5-6-15/h4,7-9,12-13,15H,3,5-6,10-11H2,1-2H3,(H,25,27) |
| InChIKey | GYSXNUYPQAGIDK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|