C24H43F3N4O4Si — CID 171536541
1-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]-4-methylcyclohexyl]-3-(4,4,4-trifluorobutyl)urea (PubChem CID 171536541) has the molecular formula C24H43F3N4O4Si and a molecular weight of 536.71 g/mol. Its IUPAC name is 1-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]-4-methylcyclohexyl]-3-(4,4,4-trifluorobutyl)urea.
| Compound Name | 1-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]-4-methylcyclohexyl]-3-(4,4,4-trifluorobutyl)urea |
|---|---|
| PubChem CID | 171536541 |
| Molecular Formula | C24H43F3N4O4Si |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 1-[4-[[5,5-dimethyl-2,4-dioxo-3-(2-trimethylsilylethoxymethyl)imidazolidin-1-yl]methyl]-4-methylcyclohexyl]-3-(4,4,4-trifluorobutyl)urea |
| SMILES | CC1(CN2C(=O)N(COCC[Si](C)(C)C)C(=O)C2(C)C)CCC(NC(=O)NCCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C24H43F3N4O4Si/c1-22(2)19(32)30(17-35-14-15-36(4,5)6)21(34)31(22)16-23(3)11-8-18(9-12-23)29-20(33)28-13-7-10-24(25,26)27/h18H,7-17H2,1-6H3,(H2,28,29,33) |
| InChIKey | MSLGYXBTKJBSJW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|