C28H50N4O4Si — CID 171536574
1-tert-butyl-3-[2-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazaspiro[4.5]decan-1-yl]spiro[3.5]nonan-7-yl]urea (PubChem CID 171536574) has the molecular formula C28H50N4O4Si and a molecular weight of 534.82 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazaspiro[4.5]decan-1-yl]spiro[3.5]nonan-7-yl]urea.
| Compound Name | 1-tert-butyl-3-[2-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazaspiro[4.5]decan-1-yl]spiro[3.5]nonan-7-yl]urea |
|---|---|
| PubChem CID | 171536574 |
| Molecular Formula | C28H50N4O4Si |
| Molecular Weight | 534.82 g/mol |
| Exact Mass | 534.36 |
| IUPAC Name | 1-tert-butyl-3-[2-[2,4-dioxo-3-(2-trimethylsilylethoxymethyl)-1,3-diazaspiro[4.5]decan-1-yl]spiro[3.5]nonan-7-yl]urea |
| SMILES | CC(C)(C)NC(=O)NC1CCC2(CC1)CC(N1C(=O)N(COCC[Si](C)(C)C)C(=O)C13CCCCC3)C2 |
| InChI | InChI=1S/C28H50N4O4Si/c1-26(2,3)30-24(34)29-21-10-14-27(15-11-21)18-22(19-27)32-25(35)31(20-36-16-17-37(4,5)6)23(33)28(32)12-8-7-9-13-28/h21-22H,7-20H2,1-6H3,(H2,29,30,34) |
| InChIKey | BSTPAJJGIIDOAB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.82 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|