C11H17F3N2O3 — CID 114173658
cis-(1R,3S)-3-(4,4,4-trifluorobutylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 114173658) has the molecular formula C11H17F3N2O3 and a molecular weight of 282.26 g/mol. Its IUPAC name is cis-(1R,3S)-3-(4,4,4-trifluorobutylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(4,4,4-trifluorobutylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114173658 |
| Molecular Formula | C11H17F3N2O3 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | cis-(1R,3S)-3-(4,4,4-trifluorobutylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCCCC(F)(F)F)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H17F3N2O3/c12-11(13,14)4-1-5-15-10(19)16-8-3-2-7(6-8)9(17)18/h7-8H,1-6H2,(H,17,18)(H2,15,16,19)/t7-,8+/m1/s1 |
| InChIKey | GYFCZPQYFLFUAQ-SFYZADRCSA-N |
| XLogP | 1.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|