C13H23N3O3 — CID 66030259
3-(2-pyrrolidin-1-ylethylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 66030259) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(2-pyrrolidin-1-ylethylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2-pyrrolidin-1-ylethylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66030259 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-(2-pyrrolidin-1-ylethylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCCN1CCCC1)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C13H23N3O3/c17-12(18)10-3-4-11(9-10)15-13(19)14-5-8-16-6-1-2-7-16/h10-11H,1-9H2,(H,17,18)(H2,14,15,19) |
| InChIKey | VHVJEXZJSRKLTR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |