C18H35N3O2 — CID 142100841
1-(4-methylcyclohexyl)-3-(2-piperidin-1-ylethyl)urea;propan-2-one (PubChem CID 142100841) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-3-(2-piperidin-1-ylethyl)urea;propan-2-one.
| Compound Name | 1-(4-methylcyclohexyl)-3-(2-piperidin-1-ylethyl)urea;propan-2-one |
|---|---|
| PubChem CID | 142100841 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 1-(4-methylcyclohexyl)-3-(2-piperidin-1-ylethyl)urea;propan-2-one |
| SMILES | CC(C)=O.CC1CCC(NC(=O)NCCN2CCCCC2)CC1 |
| InChI | InChI=1S/C15H29N3O.C3H6O/c1-13-5-7-14(8-6-13)17-15(19)16-9-12-18-10-3-2-4-11-18;1-3(2)4/h13-14H,2-12H2,1H3,(H2,16,17,19);1-2H3 |
| InChIKey | XNOJYHRZZHAMJI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |