C12H21N3O4 — CID 114173693
cis-(1R,3S)-3-[(5-amino-5-oxopentyl)carbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 114173693) has the molecular formula C12H21N3O4 and a molecular weight of 271.32 g/mol. Its IUPAC name is cis-(1R,3S)-3-[(5-amino-5-oxopentyl)carbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[(5-amino-5-oxopentyl)carbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 114173693 |
| Molecular Formula | C12H21N3O4 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | cis-(1R,3S)-3-[(5-amino-5-oxopentyl)carbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | NC(=O)CCCCNC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H21N3O4/c13-10(16)3-1-2-6-14-12(19)15-9-5-4-8(7-9)11(17)18/h8-9H,1-7H2,(H2,13,16)(H,17,18)(H2,14,15,19)/t8-,9+/m1/s1 |
| InChIKey | MKKHYJQBQNAGIE-BDAKNGLRSA-N |
| XLogP | 0.19 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|