C12H20N2O3 — CID 66032847
3-(2-cyclopropylethylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 66032847) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-(2-cyclopropylethylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2-cyclopropylethylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 66032847 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 3-(2-cyclopropylethylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(NCCC1CC1)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C12H20N2O3/c15-11(16)9-3-4-10(7-9)14-12(17)13-6-5-8-1-2-8/h8-10H,1-7H2,(H,15,16)(H2,13,14,17) |
| InChIKey | HRAUJIJEZXDLKA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |