C12H22N2O5 — CID 106319589
cis-(1R,3S)-3-[2-(2-methoxyethoxy)ethylcarbamoylamino]cyclopentane-1-carboxylic acid (PubChem CID 106319589) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is cis-(1R,3S)-3-[2-(2-methoxyethoxy)ethylcarbamoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[2-(2-methoxyethoxy)ethylcarbamoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106319589 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | cis-(1R,3S)-3-[2-(2-methoxyethoxy)ethylcarbamoylamino]cyclopentane-1-carboxylic acid |
| SMILES | COCCOCCNC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C12H22N2O5/c1-18-6-7-19-5-4-13-12(17)14-10-3-2-9(8-10)11(15)16/h9-10H,2-8H2,1H3,(H,15,16)(H2,13,14,17)/t9-,10+/m1/s1 |
| InChIKey | GZRLJGBHTZDNHI-ZJUUUORDSA-N |
| XLogP | 0.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|