C14H26N2O3S — CID 106320461
cis-(1R,3S)-3-(6-methylsulfanylhexylcarbamoylamino)cyclopentane-1-carboxylic acid (PubChem CID 106320461) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is cis-(1R,3S)-3-(6-methylsulfanylhexylcarbamoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(6-methylsulfanylhexylcarbamoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106320461 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | cis-(1R,3S)-3-(6-methylsulfanylhexylcarbamoylamino)cyclopentane-1-carboxylic acid |
| SMILES | CSCCCCCCNC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C14H26N2O3S/c1-20-9-5-3-2-4-8-15-14(19)16-12-7-6-11(10-12)13(17)18/h11-12H,2-10H2,1H3,(H,17,18)(H2,15,16,19)/t11-,12+/m1/s1 |
| InChIKey | DEGVVFUKVDSHKD-NEPJUHHUSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|