5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid

C14H26N2O3 — CID 64744106

IUPAC5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid
SMILESCC1CCC(NC(=O)NCCCCC(=O)O)CC1C
InChIInChI=1S/C14H26N2O3/c1-10-6-7-12(9-11(10)2)16-14(19)15-8-4-3-5-13(17)18/h10-12H,3-9H2,1-2H3,(H,17,18)(H2,15,16,19)
InChIKeySEGUEYVIFZMFPJ-UHFFFAOYSA-N
MW270.37 g/mol
LogP2.37
Rot. Bonds6

About 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid

5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid (PubChem CID 64744106) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid.

Molecular Properties

Compound Name5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid
PubChem CID64744106
Molecular FormulaC14H26N2O3
Molecular Weight270.37 g/mol
Exact Mass270.19
IUPAC Name5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid
SMILESCC1CCC(NC(=O)NCCCCC(=O)O)CC1C
InChIInChI=1S/C14H26N2O3/c1-10-6-7-12(9-11(10)2)16-14(19)15-8-4-3-5-13(17)18/h10-12H,3-9H2,1-2H3,(H,17,18)(H2,15,16,19)
InChIKeySEGUEYVIFZMFPJ-UHFFFAOYSA-N
XLogP2.37
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 52.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid?
The IUPAC name of 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid (CID 64744106) is 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid.
What is the SMILES notation for 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid?
The canonical SMILES for 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid is CC1CCC(NC(=O)NCCCCC(=O)O)CC1C.
What is the InChIKey of 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid?
The InChIKey is SEGUEYVIFZMFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-10-6-7-12(9-11(10)2)16-14(19)15-8-4-3-5-13(17)18/h10-12H,3-9H2,1-2H3,(H,17,18)(H2,15,16,19).
What are the key properties of 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid?
5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid has a molecular weight of 270.37 g/mol, XLogP of 2.37, 6 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,4-dimethylcyclohexyl)carbamoylamino]pentanoic acid is sourced from PubChem (CID 64744106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).