C10H17FN2O3 — CID 122014337
4-[(3-fluorocyclopentyl)carbamoylamino]butanoic acid (PubChem CID 122014337) has the molecular formula C10H17FN2O3 and a molecular weight of 232.25 g/mol. Its IUPAC name is 4-[(3-fluorocyclopentyl)carbamoylamino]butanoic acid.
| Compound Name | 4-[(3-fluorocyclopentyl)carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122014337 |
| Molecular Formula | C10H17FN2O3 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 4-[(3-fluorocyclopentyl)carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NC1CCC(F)C1 |
| InChI | InChI=1S/C10H17FN2O3/c11-7-3-4-8(6-7)13-10(16)12-5-1-2-9(14)15/h7-8H,1-6H2,(H,14,15)(H2,12,13,16) |
| InChIKey | APBKCDTXYGLVLJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|