C21H29N5O4Si — CID 156733828
2-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-oxoacetic acid (PubChem CID 156733828) has the molecular formula C21H29N5O4Si and a molecular weight of 443.58 g/mol. Its IUPAC name is 2-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 156733828 |
| Molecular Formula | C21H29N5O4Si |
| Molecular Weight | 443.58 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 2-[5-(8-methyl-[1,2,4]triazolo[1,5-a]pyridin-6-yl)-4-propan-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-oxoacetic acid |
| SMILES | Cc1cc(-c2c(C(C)C)c(C(=O)C(=O)O)nn2COCC[Si](C)(C)C)cn2ncnc12 |
| InChI | InChI=1S/C21H29N5O4Si/c1-13(2)16-17(19(27)21(28)29)24-26(12-30-7-8-31(4,5)6)18(16)15-9-14(3)20-22-11-23-25(20)10-15/h9-11,13H,7-8,12H2,1-6H3,(H,28,29) |
| InChIKey | VBQSWIKGTFFREA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|