C29H32N4O5Si — CID 91348983
(5R)-5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(4-pyridin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione (PubChem CID 91348983) has the molecular formula C29H32N4O5Si and a molecular weight of 544.68 g/mol. Its IUPAC name is (5R)-5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(4-pyridin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(4-pyridin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 91348983 |
| Molecular Formula | C29H32N4O5Si |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | (5R)-5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(4-pyridin-4-ylphenyl)-3-(2-trimethylsilylethoxymethyl)imidazolidine-2,4-dione |
| SMILES | C[Si](C)(C)CCOCN1C(=O)N[C@@](Cn2cc3ccc(O)cc3c2O)(c2ccc(-c3ccncc3)cc2)C1=O |
| InChI | InChI=1S/C29H32N4O5Si/c1-39(2,3)15-14-38-19-33-27(36)29(31-28(33)37,18-32-17-22-6-9-24(34)16-25(22)26(32)35)23-7-4-20(5-8-23)21-10-12-30-13-11-21/h4-13,16-17,34-35H,14-15,18-19H2,1-3H3,(H,31,37)/t29-/m0/s1 |
| InChIKey | OEVLDEPWYZAMLL-LJAQVGFWSA-N |
| XLogP | 4.87 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|